C26H36O4Sn — CID 139672402
[dibutyl-(2,3-dimethylbenzoyl)oxystannyl] 2,3-dimethylbenzoate (PubChem CID 139672402) has the molecular formula C26H36O4Sn and a molecular weight of 531.28 g/mol. Its IUPAC name is [dibutyl-(2,3-dimethylbenzoyl)oxystannyl] 2,3-dimethylbenzoate.
| Compound Name | [dibutyl-(2,3-dimethylbenzoyl)oxystannyl] 2,3-dimethylbenzoate |
|---|---|
| PubChem CID | 139672402 |
| Molecular Formula | C26H36O4Sn |
| Molecular Weight | 531.28 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | [dibutyl-(2,3-dimethylbenzoyl)oxystannyl] 2,3-dimethylbenzoate |
| SMILES | CCCC[Sn](CCCC)(OC(=O)c1cccc(C)c1C)OC(=O)c1cccc(C)c1C |
| InChI | InChI=1S/2C9H10O2.2C4H9.Sn/c2*1-6-4-3-5-8(7(6)2)9(10)11;2*1-3-4-2;/h2*3-5H,1-2H3,(H,10,11);2*1,3-4H2,2H3;/q;;;;+2/p-2 |
| InChIKey | NAZVEHYWALRMQN-UHFFFAOYSA-L |
| XLogP | 6.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.28 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |