About trioctylstannyl naphthalene-1-carboxylate
trioctylstannyl naphthalene-1-carboxylate (PubChem CID 140558315) has the molecular formula C35H58O2Sn
and a molecular weight of 629.56 g/mol. Its IUPAC name is trioctylstannyl naphthalene-1-carboxylate.
Molecular Properties
| Compound Name | trioctylstannyl naphthalene-1-carboxylate |
| PubChem CID | 140558315 |
| Molecular Formula | C35H58O2Sn |
| Molecular Weight | 629.56 g/mol |
| Exact Mass | 630.35 |
| IUPAC Name | trioctylstannyl naphthalene-1-carboxylate |
| SMILES | CCCCCCCC[Sn](CCCCCCCC)(CCCCCCCC)OC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C11H8O2.3C8H17.Sn/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10;3*1-3-5-7-8-6-4-2;/h1-7H,(H,12,13);3*1,3-8H2,2H3;/q;;;;+1/p-1 |
| InChIKey | VMENROYJEWJMFS-UHFFFAOYSA-M |
| XLogP | 12.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 629.56 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze trioctylstannyl naphthalene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trioctylstannyl naphthalene-1-carboxylate?
The IUPAC name of trioctylstannyl naphthalene-1-carboxylate (CID 140558315) is trioctylstannyl naphthalene-1-carboxylate.
What is the SMILES notation for trioctylstannyl naphthalene-1-carboxylate?
The canonical SMILES for trioctylstannyl naphthalene-1-carboxylate is CCCCCCCC[Sn](CCCCCCCC)(CCCCCCCC)OC(=O)c1cccc2ccccc12.
What is the InChIKey of trioctylstannyl naphthalene-1-carboxylate?
The InChIKey is VMENROYJEWJMFS-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H8O2.3C8H17.Sn/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10;3*1-3-5-7-8-6-4-2;/h1-7H,(H,12,13);3*1,3-8H2,2H3;/q;;;;+1/p-1.
What are the key properties of trioctylstannyl naphthalene-1-carboxylate?
trioctylstannyl naphthalene-1-carboxylate has a molecular weight of 629.56 g/mol, XLogP of 12.02, 23 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trioctylstannyl naphthalene-1-carboxylate is sourced from PubChem (CID 140558315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).