C15H26 — CID 159405289
hexane;1,2,3-trimethylbenzene (PubChem CID 159405289) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is hexane;1,2,3-trimethylbenzene.
| Compound Name | hexane;1,2,3-trimethylbenzene |
|---|---|
| PubChem CID | 159405289 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | hexane;1,2,3-trimethylbenzene |
| SMILES | CCCCCC.Cc1cccc(C)c1C |
| InChI | InChI=1S/C9H12.C6H14/c1-7-5-4-6-8(2)9(7)3;1-3-5-6-4-2/h4-6H,1-3H3;3-6H2,1-2H3 |
| InChIKey | LNWLHKYKKNVXFQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|