C13H18N2O3 — CID 17337785
N-[(E)-hexan-2-ylideneamino]-2,5-dihydroxybenzamide (PubChem CID 17337785) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is N-[(E)-hexan-2-ylideneamino]-2,5-dihydroxybenzamide.
| Compound Name | N-[(E)-hexan-2-ylideneamino]-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 17337785 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | N-[(E)-hexan-2-ylideneamino]-2,5-dihydroxybenzamide |
| SMILES | CCCC/C(C)=N/NC(=O)c1cc(O)ccc1O |
| InChI | InChI=1S/C13H18N2O3/c1-3-4-5-9(2)14-15-13(18)11-8-10(16)6-7-12(11)17/h6-8,16-17H,3-5H2,1-2H3,(H,15,18)/b14-9+ |
| InChIKey | ZNRTZSTZHQTHQI-NTEUORMPSA-N |
| XLogP | 2.39 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|