C19H20N2O4 — CID 141408132
2-hydroxy-3-(2-hydroxybenzoyl)-N-[(E)-pentan-2-ylideneamino]benzamide (PubChem CID 141408132) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-hydroxy-3-(2-hydroxybenzoyl)-N-[(E)-pentan-2-ylideneamino]benzamide.
| Compound Name | 2-hydroxy-3-(2-hydroxybenzoyl)-N-[(E)-pentan-2-ylideneamino]benzamide |
|---|---|
| PubChem CID | 141408132 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 2-hydroxy-3-(2-hydroxybenzoyl)-N-[(E)-pentan-2-ylideneamino]benzamide |
| SMILES | CCC/C(C)=N/NC(=O)c1cccc(C(=O)c2ccccc2O)c1O |
| InChI | InChI=1S/C19H20N2O4/c1-3-7-12(2)20-21-19(25)15-10-6-9-14(18(15)24)17(23)13-8-4-5-11-16(13)22/h4-6,8-11,22,24H,3,7H2,1-2H3,(H,21,25)/b20-12+ |
| InChIKey | RBZZWCUSUMBEQN-UDWIEESQSA-N |
| XLogP | 3.23 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|