C17H16IN3O3 — CID 5371078
2-hydroxy-N-[(Z)-[4-(3-iodoanilino)-4-oxobutan-2-ylidene]amino]benzamide (PubChem CID 5371078) has the molecular formula C17H16IN3O3 and a molecular weight of 437.24 g/mol. Its IUPAC name is 2-hydroxy-N-[(Z)-[4-(3-iodoanilino)-4-oxobutan-2-ylidene]amino]benzamide.
| Compound Name | 2-hydroxy-N-[(Z)-[4-(3-iodoanilino)-4-oxobutan-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 5371078 |
| Molecular Formula | C17H16IN3O3 |
| Molecular Weight | 437.24 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | 2-hydroxy-N-[(Z)-[4-(3-iodoanilino)-4-oxobutan-2-ylidene]amino]benzamide |
| SMILES | C/C(CC(=O)Nc1cccc(I)c1)=N/NC(=O)c1ccccc1O |
| InChI | InChI=1S/C17H16IN3O3/c1-11(9-16(23)19-13-6-4-5-12(18)10-13)20-21-17(24)14-7-2-3-8-15(14)22/h2-8,10,22H,9H2,1H3,(H,19,23)(H,21,24)/b20-11- |
| InChIKey | DWOVWVZQJXZWRT-JAIQZWGSSA-N |
| XLogP | 3.13 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|