C19H18F3N3O3 — CID 2889180
2-hydroxy-3-methyl-N-[[4-oxo-4-[3-(trifluoromethyl)anilino]butan-2-ylidene]amino]benzamide (PubChem CID 2889180) has the molecular formula C19H18F3N3O3 and a molecular weight of 393.37 g/mol. Its IUPAC name is 2-hydroxy-3-methyl-N-[[4-oxo-4-[3-(trifluoromethyl)anilino]butan-2-ylidene]amino]benzamide.
| Compound Name | 2-hydroxy-3-methyl-N-[[4-oxo-4-[3-(trifluoromethyl)anilino]butan-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 2889180 |
| Molecular Formula | C19H18F3N3O3 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 2-hydroxy-3-methyl-N-[[4-oxo-4-[3-(trifluoromethyl)anilino]butan-2-ylidene]amino]benzamide |
| SMILES | CC(CC(=O)Nc1cccc(C(F)(F)F)c1)=NNC(=O)c1cccc(C)c1O |
| InChI | InChI=1S/C19H18F3N3O3/c1-11-5-3-8-15(17(11)27)18(28)25-24-12(2)9-16(26)23-14-7-4-6-13(10-14)19(20,21)22/h3-8,10,27H,9H2,1-2H3,(H,23,26)(H,25,28) |
| InChIKey | HOQNCFMUJSJSCX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|