C12H15F3N3O2+ — CID 8771629
[2-(methylamino)-2-oxoethyl]-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]azanium (PubChem CID 8771629) has the molecular formula C12H15F3N3O2+ and a molecular weight of 290.27 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl]-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]azanium.
| Compound Name | [2-(methylamino)-2-oxoethyl]-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]azanium |
|---|---|
| PubChem CID | 8771629 |
| Molecular Formula | C12H15F3N3O2+ |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl]-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]azanium |
| SMILES | CNC(=O)C[NH2+]CC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3N3O2/c1-16-10(19)6-17-7-11(20)18-9-4-2-3-8(5-9)12(13,14)15/h2-5,17H,6-7H2,1H3,(H,16,19)(H,18,20)/p+1 |
| InChIKey | WBYMRKYGOQFNGY-UHFFFAOYSA-O |
| XLogP | -0.05 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |