C11H15FN3O2+ — CID 8771641
[2-(4-fluoroanilino)-2-oxoethyl]-[2-(methylamino)-2-oxoethyl]azanium (PubChem CID 8771641) has the molecular formula C11H15FN3O2+ and a molecular weight of 240.26 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-2-oxoethyl]-[2-(methylamino)-2-oxoethyl]azanium.
| Compound Name | [2-(4-fluoroanilino)-2-oxoethyl]-[2-(methylamino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8771641 |
| Molecular Formula | C11H15FN3O2+ |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | [2-(4-fluoroanilino)-2-oxoethyl]-[2-(methylamino)-2-oxoethyl]azanium |
| SMILES | CNC(=O)C[NH2+]CC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C11H14FN3O2/c1-13-10(16)6-14-7-11(17)15-9-4-2-8(12)3-5-9/h2-5,14H,6-7H2,1H3,(H,13,16)(H,15,17)/p+1 |
| InChIKey | VJPMVBXCYDLMFA-UHFFFAOYSA-O |
| XLogP | -0.93 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |