C15H22N3O4+ — CID 8772437
[2-(methylamino)-2-oxoethyl]-[2-oxo-2-(4-propan-2-yloxycarbonylanilino)ethyl]azanium (PubChem CID 8772437) has the molecular formula C15H22N3O4+ and a molecular weight of 308.36 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl]-[2-oxo-2-(4-propan-2-yloxycarbonylanilino)ethyl]azanium.
| Compound Name | [2-(methylamino)-2-oxoethyl]-[2-oxo-2-(4-propan-2-yloxycarbonylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 8772437 |
| Molecular Formula | C15H22N3O4+ |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl]-[2-oxo-2-(4-propan-2-yloxycarbonylanilino)ethyl]azanium |
| SMILES | CNC(=O)C[NH2+]CC(=O)Nc1ccc(C(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C15H21N3O4/c1-10(2)22-15(21)11-4-6-12(7-5-11)18-14(20)9-17-8-13(19)16-3/h4-7,10,17H,8-9H2,1-3H3,(H,16,19)(H,18,20)/p+1 |
| InChIKey | NWTCSKFNKISNAC-UHFFFAOYSA-O |
| XLogP | -0.50 |
| TPSA | 101.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |