C16H11F6NO2 — CID 57459273
N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-3-methylbenzamide (PubChem CID 57459273) has the molecular formula C16H11F6NO2 and a molecular weight of 363.26 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-3-methylbenzamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-3-methylbenzamide |
|---|---|
| PubChem CID | 57459273 |
| Molecular Formula | C16H11F6NO2 |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C16H11F6NO2/c1-8-3-2-4-12(13(8)24)14(25)23-11-6-9(15(17,18)19)5-10(7-11)16(20,21)22/h2-7,24H,1H3,(H,23,25) |
| InChIKey | ORCCGGZDTIMIAI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |