C17H12F6N2O3 — CID 71554885
5-acetamido-N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxybenzamide (PubChem CID 71554885) has the molecular formula C17H12F6N2O3 and a molecular weight of 406.28 g/mol. Its IUPAC name is 5-acetamido-N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxybenzamide.
| Compound Name | 5-acetamido-N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 71554885 |
| Molecular Formula | C17H12F6N2O3 |
| Molecular Weight | 406.28 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 5-acetamido-N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxybenzamide |
| SMILES | CC(=O)Nc1ccc(O)c(C(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C17H12F6N2O3/c1-8(26)24-11-2-3-14(27)13(7-11)15(28)25-12-5-9(16(18,19)20)4-10(6-12)17(21,22)23/h2-7,27H,1H3,(H,24,26)(H,25,28) |
| InChIKey | ZYGPHJOZMCLUGH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.28 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|