C19H12F6N2O4S — CID 10050743
N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-pyrrol-1-ylsulfonylbenzamide (PubChem CID 10050743) has the molecular formula C19H12F6N2O4S and a molecular weight of 478.37 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-pyrrol-1-ylsulfonylbenzamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-pyrrol-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 10050743 |
| Molecular Formula | C19H12F6N2O4S |
| Molecular Weight | 478.37 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-pyrrol-1-ylsulfonylbenzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(S(=O)(=O)n2cccc2)ccc1O |
| InChI | InChI=1S/C19H12F6N2O4S/c20-18(21,22)11-7-12(19(23,24)25)9-13(8-11)26-17(29)15-10-14(3-4-16(15)28)32(30,31)27-5-1-2-6-27/h1-10,28H,(H,26,29) |
| InChIKey | FQAFWZQDELNPCV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.37 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |