C14H10F6N2O — CID 162733829
N-[3,5-bis(trifluoromethyl)phenyl]-1-methylpyrrole-2-carboxamide (PubChem CID 162733829) has the molecular formula C14H10F6N2O and a molecular weight of 336.24 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 162733829 |
| Molecular Formula | C14H10F6N2O |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cccc1C(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H10F6N2O/c1-22-4-2-3-11(22)12(23)21-10-6-8(13(15,16)17)5-9(7-10)14(18,19)20/h2-7H,1H3,(H,21,23) |
| InChIKey | NBOFKQLGVRCNCY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |