C24H11F12NO4 — CID 11192744
[3,5-bis(trifluoromethyl)phenyl] 3-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]-4-hydroxybenzoate (PubChem CID 11192744) has the molecular formula C24H11F12NO4 and a molecular weight of 605.33 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl] 3-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]-4-hydroxybenzoate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl] 3-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]-4-hydroxybenzoate |
|---|---|
| PubChem CID | 11192744 |
| Molecular Formula | C24H11F12NO4 |
| Molecular Weight | 605.33 g/mol |
| Exact Mass | 605.05 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl] 3-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]-4-hydroxybenzoate |
| SMILES | O=C(Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(O)c(C(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C24H11F12NO4/c25-21(26,27)11-4-12(22(28,29)30)7-15(6-11)37-19(39)17-3-10(1-2-18(17)38)20(40)41-16-8-13(23(31,32)33)5-14(9-16)24(34,35)36/h1-9,38H,(H,37,39) |
| InChIKey | IAVJKJLTUAHCER-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.33 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|