C27H18F3NO3 — CID 22081571
2-hydroxy-5-(4-phenylbenzoyl)-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 22081571) has the molecular formula C27H18F3NO3 and a molecular weight of 461.44 g/mol. Its IUPAC name is 2-hydroxy-5-(4-phenylbenzoyl)-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-hydroxy-5-(4-phenylbenzoyl)-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 22081571 |
| Molecular Formula | C27H18F3NO3 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 2-hydroxy-5-(4-phenylbenzoyl)-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(c1ccc(-c2ccccc2)cc1)c1ccc(O)c(C(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C27H18F3NO3/c28-27(29,30)21-7-4-8-22(16-21)31-26(34)23-15-20(13-14-24(23)32)25(33)19-11-9-18(10-12-19)17-5-2-1-3-6-17/h1-16,32H,(H,31,34) |
| InChIKey | MPDOQLQWAKNLJX-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |