C12H12F3N3O2 — CID 3396370
3-(formylhydrazinylidene)-N-[3-(trifluoromethyl)phenyl]butanamide (PubChem CID 3396370) has the molecular formula C12H12F3N3O2 and a molecular weight of 287.24 g/mol. Its IUPAC name is 3-(formylhydrazinylidene)-N-[3-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 3-(formylhydrazinylidene)-N-[3-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 3396370 |
| Molecular Formula | C12H12F3N3O2 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 3-(formylhydrazinylidene)-N-[3-(trifluoromethyl)phenyl]butanamide |
| SMILES | CC(CC(=O)Nc1cccc(C(F)(F)F)c1)=NNC=O |
| InChI | InChI=1S/C12H12F3N3O2/c1-8(18-16-7-19)5-11(20)17-10-4-2-3-9(6-10)12(13,14)15/h2-4,6-7H,5H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | NSVOKISDGRMBFE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|