C19H16Cl2F3N3O3 — CID 4587745
3-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]-N-[3-(trifluoromethyl)phenyl]butanamide (PubChem CID 4587745) has the molecular formula C19H16Cl2F3N3O3 and a molecular weight of 462.26 g/mol. Its IUPAC name is 3-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]-N-[3-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 3-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]-N-[3-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 4587745 |
| Molecular Formula | C19H16Cl2F3N3O3 |
| Molecular Weight | 462.26 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | 3-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]-N-[3-(trifluoromethyl)phenyl]butanamide |
| SMILES | CC(CC(=O)Nc1cccc(C(F)(F)F)c1)=NNC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H16Cl2F3N3O3/c1-11(7-17(28)25-14-4-2-3-12(8-14)19(22,23)24)26-27-18(29)10-30-16-6-5-13(20)9-15(16)21/h2-6,8-9H,7,10H2,1H3,(H,25,28)(H,27,29) |
| InChIKey | FUEJWYPKGYJRQK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.26 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|