C21H20ClF3N4O4 — CID 126179111
N'-[(Z)-[5-chloro-2-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-propan-2-yloxamide (PubChem CID 126179111) has the molecular formula C21H20ClF3N4O4 and a molecular weight of 484.86 g/mol. Its IUPAC name is N'-[(Z)-[5-chloro-2-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-propan-2-yloxamide.
| Compound Name | N'-[(Z)-[5-chloro-2-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-propan-2-yloxamide |
|---|---|
| PubChem CID | 126179111 |
| Molecular Formula | C21H20ClF3N4O4 |
| Molecular Weight | 484.86 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | N'-[(Z)-[5-chloro-2-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-propan-2-yloxamide |
| SMILES | CC(C)NC(=O)C(=O)N/N=C\c1cc(Cl)ccc1OCC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H20ClF3N4O4/c1-12(2)27-19(31)20(32)29-26-10-13-8-15(22)6-7-17(13)33-11-18(30)28-16-5-3-4-14(9-16)21(23,24)25/h3-10,12H,11H2,1-2H3,(H,27,31)(H,28,30)(H,29,32)/b26-10- |
| InChIKey | LTCWRTPDTQFJKE-KALUYTGESA-N |
| XLogP | 3.35 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.86 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|