C22H21BrClF3N4O4 — CID 126159863
N'-[(Z)-[2-[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethoxy]-5-chlorophenyl]methylideneamino]-N-[(2S)-butan-2-yl]oxamide (PubChem CID 126159863) has the molecular formula C22H21BrClF3N4O4 and a molecular weight of 577.79 g/mol. Its IUPAC name is N'-[(Z)-[2-[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethoxy]-5-chlorophenyl]methylideneamino]-N-[(2S)-butan-2-yl]oxamide.
| Compound Name | N'-[(Z)-[2-[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethoxy]-5-chlorophenyl]methylideneamino]-N-[(2S)-butan-2-yl]oxamide |
|---|---|
| PubChem CID | 126159863 |
| Molecular Formula | C22H21BrClF3N4O4 |
| Molecular Weight | 577.79 g/mol |
| Exact Mass | 576.04 |
| IUPAC Name | N'-[(Z)-[2-[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethoxy]-5-chlorophenyl]methylideneamino]-N-[(2S)-butan-2-yl]oxamide |
| SMILES | CC[C@H](C)NC(=O)C(=O)N/N=C\c1cc(Cl)ccc1OCC(=O)Nc1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C22H21BrClF3N4O4/c1-3-12(2)29-20(33)21(34)31-28-10-13-8-15(24)5-7-18(13)35-11-19(32)30-17-6-4-14(23)9-16(17)22(25,26)27/h4-10,12H,3,11H2,1-2H3,(H,29,33)(H,30,32)(H,31,34)/b28-10-/t12-/m0/s1 |
| InChIKey | MCXNJJMZKLSSMV-IGXDZFCGSA-N |
| XLogP | 4.50 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.79 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|