C22H24BrClN4O4 — CID 126268636
N'-[(Z)-[5-bromo-2-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[(2S)-butan-2-yl]oxamide (PubChem CID 126268636) has the molecular formula C22H24BrClN4O4 and a molecular weight of 523.82 g/mol. Its IUPAC name is N'-[(Z)-[5-bromo-2-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[(2S)-butan-2-yl]oxamide.
| Compound Name | N'-[(Z)-[5-bromo-2-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[(2S)-butan-2-yl]oxamide |
|---|---|
| PubChem CID | 126268636 |
| Molecular Formula | C22H24BrClN4O4 |
| Molecular Weight | 523.82 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | N'-[(Z)-[5-bromo-2-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[(2S)-butan-2-yl]oxamide |
| SMILES | CC[C@H](C)NC(=O)C(=O)N/N=C\c1cc(Br)ccc1OCC(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C22H24BrClN4O4/c1-4-14(3)26-21(30)22(31)28-25-11-15-9-16(23)6-8-19(15)32-12-20(29)27-17-7-5-13(2)18(24)10-17/h5-11,14H,4,12H2,1-3H3,(H,26,30)(H,27,29)(H,28,31)/b25-11-/t14-/m0/s1 |
| InChIKey | FBSXTLLWYXWPER-MVJNIROCSA-N |
| XLogP | 3.79 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.82 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|