C26H24BrClN4O5 — CID 126182516
N'-[(Z)-[5-bromo-2-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-ethoxyphenyl)oxamide (PubChem CID 126182516) has the molecular formula C26H24BrClN4O5 and a molecular weight of 587.86 g/mol. Its IUPAC name is N'-[(Z)-[5-bromo-2-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-ethoxyphenyl)oxamide.
| Compound Name | N'-[(Z)-[5-bromo-2-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-ethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 126182516 |
| Molecular Formula | C26H24BrClN4O5 |
| Molecular Weight | 587.86 g/mol |
| Exact Mass | 586.06 |
| IUPAC Name | N'-[(Z)-[5-bromo-2-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-ethoxyphenyl)oxamide |
| SMILES | CCOc1ccccc1NC(=O)C(=O)N/N=C\c1cc(Br)ccc1OCC(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C26H24BrClN4O5/c1-3-36-23-7-5-4-6-21(23)31-25(34)26(35)32-29-14-17-12-18(27)9-11-22(17)37-15-24(33)30-19-10-8-16(2)20(28)13-19/h4-14H,3,15H2,1-2H3,(H,30,33)(H,31,34)(H,32,35)/b29-14- |
| InChIKey | ZDNNZHATGJZAFL-NUJZUDFISA-N |
| XLogP | 4.92 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.86 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|