C27H24BrClN4O5 — CID 126166689
N'-[(Z)-[5-bromo-2-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-prop-2-enoxyphenyl)oxamide (PubChem CID 126166689) has the molecular formula C27H24BrClN4O5 and a molecular weight of 599.87 g/mol. Its IUPAC name is N'-[(Z)-[5-bromo-2-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-prop-2-enoxyphenyl)oxamide.
| Compound Name | N'-[(Z)-[5-bromo-2-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-prop-2-enoxyphenyl)oxamide |
|---|---|
| PubChem CID | 126166689 |
| Molecular Formula | C27H24BrClN4O5 |
| Molecular Weight | 599.87 g/mol |
| Exact Mass | 598.06 |
| IUPAC Name | N'-[(Z)-[5-bromo-2-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-prop-2-enoxyphenyl)oxamide |
| SMILES | C=CCOc1ccc(NC(=O)C(=O)N/N=C\c2cc(Br)ccc2OCC(=O)Nc2ccc(C)c(Cl)c2)cc1 |
| InChI | InChI=1S/C27H24BrClN4O5/c1-3-12-37-22-9-7-20(8-10-22)32-26(35)27(36)33-30-15-18-13-19(28)5-11-24(18)38-16-25(34)31-21-6-4-17(2)23(29)14-21/h3-11,13-15H,1,12,16H2,2H3,(H,31,34)(H,32,35)(H,33,36)/b30-15- |
| InChIKey | YFZJTDOCKBQLIE-MNDYBZJGSA-N |
| XLogP | 5.08 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.87 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|