C27H23BrClF3N4O5 — CID 126164860
N'-[(Z)-[2-[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethoxy]-5-chlorophenyl]methylideneamino]-N-(4-propoxyphenyl)oxamide (PubChem CID 126164860) has the molecular formula C27H23BrClF3N4O5 and a molecular weight of 655.86 g/mol. Its IUPAC name is N'-[(Z)-[2-[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethoxy]-5-chlorophenyl]methylideneamino]-N-(4-propoxyphenyl)oxamide.
| Compound Name | N'-[(Z)-[2-[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethoxy]-5-chlorophenyl]methylideneamino]-N-(4-propoxyphenyl)oxamide |
|---|---|
| PubChem CID | 126164860 |
| Molecular Formula | C27H23BrClF3N4O5 |
| Molecular Weight | 655.86 g/mol |
| Exact Mass | 654.05 |
| IUPAC Name | N'-[(Z)-[2-[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethoxy]-5-chlorophenyl]methylideneamino]-N-(4-propoxyphenyl)oxamide |
| SMILES | CCCOc1ccc(NC(=O)C(=O)N/N=C\c2cc(Cl)ccc2OCC(=O)Nc2ccc(Br)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H23BrClF3N4O5/c1-2-11-40-20-7-5-19(6-8-20)34-25(38)26(39)36-33-14-16-12-18(29)4-10-23(16)41-15-24(37)35-22-9-3-17(28)13-21(22)27(30,31)32/h3-10,12-14H,2,11,15H2,1H3,(H,34,38)(H,35,37)(H,36,39)/b33-14- |
| InChIKey | UBPUUQMGBVFTIH-DMWKKASYSA-N |
| XLogP | 6.02 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.86 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|