C28H28BrFN4O6 — CID 126173835
N'-[(Z)-[4-[2-(4-bromo-2-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-(4-butoxyphenyl)oxamide (PubChem CID 126173835) has the molecular formula C28H28BrFN4O6 and a molecular weight of 615.46 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(4-bromo-2-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-(4-butoxyphenyl)oxamide.
| Compound Name | N'-[(Z)-[4-[2-(4-bromo-2-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-(4-butoxyphenyl)oxamide |
|---|---|
| PubChem CID | 126173835 |
| Molecular Formula | C28H28BrFN4O6 |
| Molecular Weight | 615.46 g/mol |
| Exact Mass | 614.12 |
| IUPAC Name | N'-[(Z)-[4-[2-(4-bromo-2-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-(4-butoxyphenyl)oxamide |
| SMILES | CCCCOc1ccc(NC(=O)C(=O)N/N=C\c2ccc(OCC(=O)Nc3ccc(Br)cc3F)c(OC)c2)cc1 |
| InChI | InChI=1S/C28H28BrFN4O6/c1-3-4-13-39-21-9-7-20(8-10-21)32-27(36)28(37)34-31-16-18-5-12-24(25(14-18)38-2)40-17-26(35)33-23-11-6-19(29)15-22(23)30/h5-12,14-16H,3-4,13,17H2,1-2H3,(H,32,36)(H,33,35)(H,34,37)/b31-16- |
| InChIKey | JCMLVRTWMRWONU-ACXHZZMFSA-N |
| XLogP | 4.88 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|