C28H26BrF3N4O5 — CID 126182116
N'-[(Z)-[4-[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethoxy]phenyl]methylideneamino]-N-(4-butoxyphenyl)oxamide (PubChem CID 126182116) has the molecular formula C28H26BrF3N4O5 and a molecular weight of 635.44 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethoxy]phenyl]methylideneamino]-N-(4-butoxyphenyl)oxamide.
| Compound Name | N'-[(Z)-[4-[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethoxy]phenyl]methylideneamino]-N-(4-butoxyphenyl)oxamide |
|---|---|
| PubChem CID | 126182116 |
| Molecular Formula | C28H26BrF3N4O5 |
| Molecular Weight | 635.44 g/mol |
| Exact Mass | 634.10 |
| IUPAC Name | N'-[(Z)-[4-[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethoxy]phenyl]methylideneamino]-N-(4-butoxyphenyl)oxamide |
| SMILES | CCCCOc1ccc(NC(=O)C(=O)N/N=C\c2ccc(OCC(=O)Nc3ccc(Br)cc3C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H26BrF3N4O5/c1-2-3-14-40-21-11-7-20(8-12-21)34-26(38)27(39)36-33-16-18-4-9-22(10-5-18)41-17-25(37)35-24-13-6-19(29)15-23(24)28(30,31)32/h4-13,15-16H,2-3,14,17H2,1H3,(H,34,38)(H,35,37)(H,36,39)/b33-16- |
| InChIKey | VNNHJYSKAYAEKW-BJUCDSOZSA-N |
| XLogP | 5.75 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.44 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|