C28H25BrClF3N4O5 — CID 126181509
N'-[(Z)-[2-[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethoxy]-5-chlorophenyl]methylideneamino]-N-(4-butoxyphenyl)oxamide (PubChem CID 126181509) has the molecular formula C28H25BrClF3N4O5 and a molecular weight of 669.88 g/mol. Its IUPAC name is N'-[(Z)-[2-[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethoxy]-5-chlorophenyl]methylideneamino]-N-(4-butoxyphenyl)oxamide.
| Compound Name | N'-[(Z)-[2-[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethoxy]-5-chlorophenyl]methylideneamino]-N-(4-butoxyphenyl)oxamide |
|---|---|
| PubChem CID | 126181509 |
| Molecular Formula | C28H25BrClF3N4O5 |
| Molecular Weight | 669.88 g/mol |
| Exact Mass | 668.06 |
| IUPAC Name | N'-[(Z)-[2-[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethoxy]-5-chlorophenyl]methylideneamino]-N-(4-butoxyphenyl)oxamide |
| SMILES | CCCCOc1ccc(NC(=O)C(=O)N/N=C\c2cc(Cl)ccc2OCC(=O)Nc2ccc(Br)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H25BrClF3N4O5/c1-2-3-12-41-21-8-6-20(7-9-21)35-26(39)27(40)37-34-15-17-13-19(30)5-11-24(17)42-16-25(38)36-23-10-4-18(29)14-22(23)28(31,32)33/h4-11,13-15H,2-3,12,16H2,1H3,(H,35,39)(H,36,38)(H,37,40)/b34-15- |
| InChIKey | ZEWOCBPUPHGHED-PMNVOCJDSA-N |
| XLogP | 6.41 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.88 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|