C28H29ClN4O5 — CID 126181289
N'-[(Z)-[5-chloro-2-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-propoxyphenyl)oxamide (PubChem CID 126181289) has the molecular formula C28H29ClN4O5 and a molecular weight of 537.02 g/mol. Its IUPAC name is N'-[(Z)-[5-chloro-2-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-propoxyphenyl)oxamide.
| Compound Name | N'-[(Z)-[5-chloro-2-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-propoxyphenyl)oxamide |
|---|---|
| PubChem CID | 126181289 |
| Molecular Formula | C28H29ClN4O5 |
| Molecular Weight | 537.02 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | N'-[(Z)-[5-chloro-2-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-propoxyphenyl)oxamide |
| SMILES | CCCOc1ccc(NC(=O)C(=O)N/N=C\c2cc(Cl)ccc2OCC(=O)Nc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C28H29ClN4O5/c1-4-13-37-23-10-8-22(9-11-23)31-27(35)28(36)33-30-16-20-15-21(29)7-12-25(20)38-17-26(34)32-24-14-18(2)5-6-19(24)3/h5-12,14-16H,4,13,17H2,1-3H3,(H,31,35)(H,32,34)(H,33,36)/b30-16- |
| InChIKey | XTKKKESLFHFWOW-UHBFCERESA-N |
| XLogP | 4.85 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.02 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|