C26H20BrF3N4O6 — CID 126180476
N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[4-[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethoxy]phenyl]methylideneamino]oxamide (PubChem CID 126180476) has the molecular formula C26H20BrF3N4O6 and a molecular weight of 621.37 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[4-[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[4-[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126180476 |
| Molecular Formula | C26H20BrF3N4O6 |
| Molecular Weight | 621.37 g/mol |
| Exact Mass | 620.05 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[4-[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethoxy]phenyl]methylideneamino]oxamide |
| SMILES | O=C(COc1ccc(/C=N\NC(=O)C(=O)NCc2ccc3c(c2)OCO3)cc1)Nc1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C26H20BrF3N4O6/c27-17-4-7-20(19(10-17)26(28,29)30)33-23(35)13-38-18-5-1-15(2-6-18)12-32-34-25(37)24(36)31-11-16-3-8-21-22(9-16)40-14-39-21/h1-10,12H,11,13-14H2,(H,31,36)(H,33,35)(H,34,37)/b32-12- |
| InChIKey | TUVGPPRMHPBDTA-ULTCEKQJSA-N |
| XLogP | 3.98 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|