C26H21F3N4O6 — CID 126162515
N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[3-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]oxamide (PubChem CID 126162515) has the molecular formula C26H21F3N4O6 and a molecular weight of 542.47 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[3-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[3-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126162515 |
| Molecular Formula | C26H21F3N4O6 |
| Molecular Weight | 542.47 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[3-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]oxamide |
| SMILES | O=C(COc1cccc(/C=N\NC(=O)C(=O)NCc2ccc3c(c2)OCO3)c1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C26H21F3N4O6/c27-26(28,29)19-6-1-2-7-20(19)32-23(34)14-37-18-5-3-4-16(10-18)13-31-33-25(36)24(35)30-12-17-8-9-21-22(11-17)39-15-38-21/h1-11,13H,12,14-15H2,(H,30,35)(H,32,34)(H,33,36)/b31-13- |
| InChIKey | NIYFMHKSXIGCHF-AAPHRLRXSA-N |
| XLogP | 3.22 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|