C21H19F3N4O4 — CID 126169649
N'-[(Z)-[3-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-prop-2-enyloxamide (PubChem CID 126169649) has the molecular formula C21H19F3N4O4 and a molecular weight of 448.40 g/mol. Its IUPAC name is N'-[(Z)-[3-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-prop-2-enyloxamide.
| Compound Name | N'-[(Z)-[3-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-prop-2-enyloxamide |
|---|---|
| PubChem CID | 126169649 |
| Molecular Formula | C21H19F3N4O4 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | N'-[(Z)-[3-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)N/N=C\c1cccc(OCC(=O)Nc2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C21H19F3N4O4/c1-2-10-25-19(30)20(31)28-26-12-14-6-5-7-15(11-14)32-13-18(29)27-17-9-4-3-8-16(17)21(22,23)24/h2-9,11-12H,1,10,13H2,(H,25,30)(H,27,29)(H,28,31)/b26-12- |
| InChIKey | QLGZOBHOGFNRJR-ZRGSRPPYSA-N |
| XLogP | 2.48 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|