C20H19F3N4O4 — CID 126164618
N-ethyl-N'-[(Z)-[3-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]oxamide (PubChem CID 126164618) has the molecular formula C20H19F3N4O4 and a molecular weight of 436.39 g/mol. Its IUPAC name is N-ethyl-N'-[(Z)-[3-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-ethyl-N'-[(Z)-[3-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126164618 |
| Molecular Formula | C20H19F3N4O4 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | N-ethyl-N'-[(Z)-[3-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]oxamide |
| SMILES | CCNC(=O)C(=O)N/N=C\c1cccc(OCC(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C20H19F3N4O4/c1-2-24-18(29)19(30)27-25-11-13-5-3-8-16(9-13)31-12-17(28)26-15-7-4-6-14(10-15)20(21,22)23/h3-11H,2,12H2,1H3,(H,24,29)(H,26,28)(H,27,30)/b25-11- |
| InChIKey | SOGTVAISQUETRC-GATIEOLUSA-N |
| XLogP | 2.31 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|