C24H20F3N3O3 — CID 5221188
N'-[[3-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-N-[3-(trifluoromethyl)phenyl]oxamide (PubChem CID 5221188) has the molecular formula C24H20F3N3O3 and a molecular weight of 455.44 g/mol. Its IUPAC name is N'-[[3-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-N-[3-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N'-[[3-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-N-[3-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 5221188 |
| Molecular Formula | C24H20F3N3O3 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N'-[[3-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-N-[3-(trifluoromethyl)phenyl]oxamide |
| SMILES | Cc1ccc(COc2cccc(C=NNC(=O)C(=O)Nc3cccc(C(F)(F)F)c3)c2)cc1 |
| InChI | InChI=1S/C24H20F3N3O3/c1-16-8-10-17(11-9-16)15-33-21-7-2-4-18(12-21)14-28-30-23(32)22(31)29-20-6-3-5-19(13-20)24(25,26)27/h2-14H,15H2,1H3,(H,29,31)(H,30,32) |
| InChIKey | IPSVWKKWMCUTCM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|