C25H25N3O3 — CID 5082451
N-(2,6-dimethylphenyl)-N'-[[3-[(4-methylphenyl)methoxy]phenyl]methylideneamino]oxamide (PubChem CID 5082451) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-N'-[[3-[(4-methylphenyl)methoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-(2,6-dimethylphenyl)-N'-[[3-[(4-methylphenyl)methoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 5082451 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-(2,6-dimethylphenyl)-N'-[[3-[(4-methylphenyl)methoxy]phenyl]methylideneamino]oxamide |
| SMILES | Cc1ccc(COc2cccc(C=NNC(=O)C(=O)Nc3c(C)cccc3C)c2)cc1 |
| InChI | InChI=1S/C25H25N3O3/c1-17-10-12-20(13-11-17)16-31-22-9-5-8-21(14-22)15-26-28-25(30)24(29)27-23-18(2)6-4-7-19(23)3/h4-15H,16H2,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | ZVWKHVXVHXICLC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|