C25H20Cl2N4O6 — CID 126181739
N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[3-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide (PubChem CID 126181739) has the molecular formula C25H20Cl2N4O6 and a molecular weight of 543.36 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[3-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[3-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126181739 |
| Molecular Formula | C25H20Cl2N4O6 |
| Molecular Weight | 543.36 g/mol |
| Exact Mass | 542.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[3-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
| SMILES | O=C(COc1cccc(/C=N\NC(=O)C(=O)NCc2ccc3c(c2)OCO3)c1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H20Cl2N4O6/c26-19-6-5-17(10-20(19)27)30-23(32)13-35-18-3-1-2-15(8-18)12-29-31-25(34)24(33)28-11-16-4-7-21-22(9-16)37-14-36-21/h1-10,12H,11,13-14H2,(H,28,33)(H,30,32)(H,31,34)/b29-12- |
| InChIKey | RNSXCRIOOHNHDN-ULPWCQAASA-N |
| XLogP | 3.51 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|