C27H25BrN4O7 — CID 126175719
N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[4-[2-(4-bromoanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]oxamide (PubChem CID 126175719) has the molecular formula C27H25BrN4O7 and a molecular weight of 597.42 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[4-[2-(4-bromoanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]oxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[4-[2-(4-bromoanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126175719 |
| Molecular Formula | C27H25BrN4O7 |
| Molecular Weight | 597.42 g/mol |
| Exact Mass | 596.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[4-[2-(4-bromoanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)NCc2ccc3c(c2)OCO3)ccc1OCC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C27H25BrN4O7/c1-2-36-23-12-18(4-9-21(23)37-15-25(33)31-20-7-5-19(28)6-8-20)14-30-32-27(35)26(34)29-13-17-3-10-22-24(11-17)39-16-38-22/h3-12,14H,2,13,15-16H2,1H3,(H,29,34)(H,31,33)(H,32,35)/b30-14- |
| InChIKey | QVBROIVWRBQYLB-CPDSRJINSA-N |
| XLogP | 3.36 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|