C27H24ClIN4O7 — CID 126181546
N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]-3-ethoxy-5-iodophenyl]methylideneamino]oxamide (PubChem CID 126181546) has the molecular formula C27H24ClIN4O7 and a molecular weight of 678.87 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]-3-ethoxy-5-iodophenyl]methylideneamino]oxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]-3-ethoxy-5-iodophenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126181546 |
| Molecular Formula | C27H24ClIN4O7 |
| Molecular Weight | 678.87 g/mol |
| Exact Mass | 678.04 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]-3-ethoxy-5-iodophenyl]methylideneamino]oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)NCc2ccc3c(c2)OCO3)cc(I)c1OCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C27H24ClIN4O7/c1-2-37-23-11-17(9-19(29)25(23)38-14-24(34)32-20-6-4-3-5-18(20)28)13-31-33-27(36)26(35)30-12-16-7-8-21-22(10-16)40-15-39-21/h3-11,13H,2,12,14-15H2,1H3,(H,30,35)(H,32,34)(H,33,36)/b31-13- |
| InChIKey | ZOMNJFWXKZHWRI-AAPHRLRXSA-N |
| XLogP | 3.86 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.87 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|