C20H21IN2O5 — CID 126152150
2-(1,3-benzodioxol-5-yl)-N-[(Z)-(3,4-diethoxy-5-iodophenyl)methylideneamino]acetamide (PubChem CID 126152150) has the molecular formula C20H21IN2O5 and a molecular weight of 496.30 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[(Z)-(3,4-diethoxy-5-iodophenyl)methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[(Z)-(3,4-diethoxy-5-iodophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126152150 |
| Molecular Formula | C20H21IN2O5 |
| Molecular Weight | 496.30 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[(Z)-(3,4-diethoxy-5-iodophenyl)methylideneamino]acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)Cc2ccc3c(c2)OCO3)cc(I)c1OCC |
| InChI | InChI=1S/C20H21IN2O5/c1-3-25-18-9-14(7-15(21)20(18)26-4-2)11-22-23-19(24)10-13-5-6-16-17(8-13)28-12-27-16/h5-9,11H,3-4,10,12H2,1-2H3,(H,23,24)/b22-11- |
| InChIKey | QGXWWZGRGKOSLC-JJFYIABZSA-N |
| XLogP | 3.51 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|