C23H16Cl2I2N2O4 — CID 126152983
2-(1,3-benzodioxol-5-yl)-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]acetamide (PubChem CID 126152983) has the molecular formula C23H16Cl2I2N2O4 and a molecular weight of 709.10 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126152983 |
| Molecular Formula | C23H16Cl2I2N2O4 |
| Molecular Weight | 709.10 g/mol |
| Exact Mass | 707.86 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)N/N=C\c1cc(I)c(OCc2ccc(Cl)cc2Cl)c(I)c1 |
| InChI | InChI=1S/C23H16Cl2I2N2O4/c24-16-3-2-15(17(25)9-16)11-31-23-18(26)5-14(6-19(23)27)10-28-29-22(30)8-13-1-4-20-21(7-13)33-12-32-20/h1-7,9-10H,8,11-12H2,(H,29,30)/b28-10- |
| InChIKey | SLBAOEBSNXJWJW-LGUSAWBASA-N |
| XLogP | 6.20 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.10 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|