C21H20BrClN4O4 — CID 126274540
N'-[(Z)-[2-[2-(4-bromo-2-methylanilino)-2-oxoethoxy]-5-chlorophenyl]methylideneamino]-N-cyclopropyloxamide (PubChem CID 126274540) has the molecular formula C21H20BrClN4O4 and a molecular weight of 507.77 g/mol. Its IUPAC name is N'-[(Z)-[2-[2-(4-bromo-2-methylanilino)-2-oxoethoxy]-5-chlorophenyl]methylideneamino]-N-cyclopropyloxamide.
| Compound Name | N'-[(Z)-[2-[2-(4-bromo-2-methylanilino)-2-oxoethoxy]-5-chlorophenyl]methylideneamino]-N-cyclopropyloxamide |
|---|---|
| PubChem CID | 126274540 |
| Molecular Formula | C21H20BrClN4O4 |
| Molecular Weight | 507.77 g/mol |
| Exact Mass | 506.04 |
| IUPAC Name | N'-[(Z)-[2-[2-(4-bromo-2-methylanilino)-2-oxoethoxy]-5-chlorophenyl]methylideneamino]-N-cyclopropyloxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)COc1ccc(Cl)cc1/C=N\NC(=O)C(=O)NC1CC1 |
| InChI | InChI=1S/C21H20BrClN4O4/c1-12-8-14(22)2-6-17(12)26-19(28)11-31-18-7-3-15(23)9-13(18)10-24-27-21(30)20(29)25-16-4-5-16/h2-3,6-10,16H,4-5,11H2,1H3,(H,25,29)(H,26,28)(H,27,30)/b24-10- |
| InChIKey | ZGQPGEQALNGDDZ-VROXFSQNSA-N |
| XLogP | 3.16 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.77 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|