C24H18Cl2F3N3O3 — CID 4300034
N'-[[5-chloro-2-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]-N-[3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 4300034) has the molecular formula C24H18Cl2F3N3O3 and a molecular weight of 524.33 g/mol. Its IUPAC name is N'-[[5-chloro-2-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]-N-[3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | N'-[[5-chloro-2-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]-N-[3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 4300034 |
| Molecular Formula | C24H18Cl2F3N3O3 |
| Molecular Weight | 524.33 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | N'-[[5-chloro-2-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]-N-[3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | O=C(CC(=O)Nc1cccc(C(F)(F)F)c1)NN=Cc1cc(Cl)ccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H18Cl2F3N3O3/c25-18-5-1-3-15(9-18)14-35-21-8-7-19(26)10-16(21)13-30-32-23(34)12-22(33)31-20-6-2-4-17(11-20)24(27,28)29/h1-11,13H,12,14H2,(H,31,33)(H,32,34) |
| InChIKey | GNNCOKYKCUWOSB-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.33 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|