C23H18BrCl2N3O3 — CID 3294440
N-(2-bromophenyl)-N'-[[5-chloro-2-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]propanediamide (PubChem CID 3294440) has the molecular formula C23H18BrCl2N3O3 and a molecular weight of 535.23 g/mol. Its IUPAC name is N-(2-bromophenyl)-N'-[[5-chloro-2-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]propanediamide.
| Compound Name | N-(2-bromophenyl)-N'-[[5-chloro-2-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]propanediamide |
|---|---|
| PubChem CID | 3294440 |
| Molecular Formula | C23H18BrCl2N3O3 |
| Molecular Weight | 535.23 g/mol |
| Exact Mass | 532.99 |
| IUPAC Name | N-(2-bromophenyl)-N'-[[5-chloro-2-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]propanediamide |
| SMILES | O=C(CC(=O)Nc1ccccc1Br)NN=Cc1cc(Cl)ccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H18BrCl2N3O3/c24-19-6-1-2-7-20(19)28-22(30)12-23(31)29-27-13-16-11-18(26)8-9-21(16)32-14-15-4-3-5-17(25)10-15/h1-11,13H,12,14H2,(H,28,30)(H,29,31) |
| InChIKey | DDAWTNBLDVOICN-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.23 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|