C18H17BrClN3O3 — CID 5206376
N-(2-bromophenyl)-N'-[(5-chloro-2-ethoxyphenyl)methylideneamino]propanediamide (PubChem CID 5206376) has the molecular formula C18H17BrClN3O3 and a molecular weight of 438.71 g/mol. Its IUPAC name is N-(2-bromophenyl)-N'-[(5-chloro-2-ethoxyphenyl)methylideneamino]propanediamide.
| Compound Name | N-(2-bromophenyl)-N'-[(5-chloro-2-ethoxyphenyl)methylideneamino]propanediamide |
|---|---|
| PubChem CID | 5206376 |
| Molecular Formula | C18H17BrClN3O3 |
| Molecular Weight | 438.71 g/mol |
| Exact Mass | 437.01 |
| IUPAC Name | N-(2-bromophenyl)-N'-[(5-chloro-2-ethoxyphenyl)methylideneamino]propanediamide |
| SMILES | CCOc1ccc(Cl)cc1C=NNC(=O)CC(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C18H17BrClN3O3/c1-2-26-16-8-7-13(20)9-12(16)11-21-23-18(25)10-17(24)22-15-6-4-3-5-14(15)19/h3-9,11H,2,10H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | YFBSTWNWTLPXEX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.71 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|