C10H12ClN3O2 — CID 5426098
[(Z)-(5-chloro-2-ethoxyphenyl)methylideneamino]urea (PubChem CID 5426098) has the molecular formula C10H12ClN3O2 and a molecular weight of 241.68 g/mol. Its IUPAC name is [(Z)-(5-chloro-2-ethoxyphenyl)methylideneamino]urea.
| Compound Name | [(Z)-(5-chloro-2-ethoxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 5426098 |
| Molecular Formula | C10H12ClN3O2 |
| Molecular Weight | 241.68 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | [(Z)-(5-chloro-2-ethoxyphenyl)methylideneamino]urea |
| SMILES | CCOc1ccc(Cl)cc1/C=N\NC(N)=O |
| InChI | InChI=1S/C10H12ClN3O2/c1-2-16-9-4-3-8(11)5-7(9)6-13-14-10(12)15/h3-6H,2H2,1H3,(H3,12,14,15)/b13-6- |
| InChIKey | HQKDSIAPCKVYAY-MLPAPPSSSA-N |
| XLogP | 1.74 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.68 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|