C15H19ClN2O2S2 — CID 6219987
N-[(Z)-(5-chloro-2-ethoxyphenyl)methylideneamino]-2-(2-methyl-1,3-dithiolan-2-yl)acetamide (PubChem CID 6219987) has the molecular formula C15H19ClN2O2S2 and a molecular weight of 358.92 g/mol. Its IUPAC name is N-[(Z)-(5-chloro-2-ethoxyphenyl)methylideneamino]-2-(2-methyl-1,3-dithiolan-2-yl)acetamide.
| Compound Name | N-[(Z)-(5-chloro-2-ethoxyphenyl)methylideneamino]-2-(2-methyl-1,3-dithiolan-2-yl)acetamide |
|---|---|
| PubChem CID | 6219987 |
| Molecular Formula | C15H19ClN2O2S2 |
| Molecular Weight | 358.92 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | N-[(Z)-(5-chloro-2-ethoxyphenyl)methylideneamino]-2-(2-methyl-1,3-dithiolan-2-yl)acetamide |
| SMILES | CCOc1ccc(Cl)cc1/C=N\NC(=O)CC1(C)SCCS1 |
| InChI | InChI=1S/C15H19ClN2O2S2/c1-3-20-13-5-4-12(16)8-11(13)10-17-18-14(19)9-15(2)21-6-7-22-15/h4-5,8,10H,3,6-7,9H2,1-2H3,(H,18,19)/b17-10- |
| InChIKey | SBKVHKRDTHMLGG-YVLHZVERSA-N |
| XLogP | 3.78 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.92 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|