C25H21ClN4O4 — CID 3580196
N'-[[5-chloro-2-[(4-cyanophenyl)methoxy]phenyl]methylideneamino]-N-(2-methoxyphenyl)propanediamide (PubChem CID 3580196) has the molecular formula C25H21ClN4O4 and a molecular weight of 476.92 g/mol. Its IUPAC name is N'-[[5-chloro-2-[(4-cyanophenyl)methoxy]phenyl]methylideneamino]-N-(2-methoxyphenyl)propanediamide.
| Compound Name | N'-[[5-chloro-2-[(4-cyanophenyl)methoxy]phenyl]methylideneamino]-N-(2-methoxyphenyl)propanediamide |
|---|---|
| PubChem CID | 3580196 |
| Molecular Formula | C25H21ClN4O4 |
| Molecular Weight | 476.92 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | N'-[[5-chloro-2-[(4-cyanophenyl)methoxy]phenyl]methylideneamino]-N-(2-methoxyphenyl)propanediamide |
| SMILES | COc1ccccc1NC(=O)CC(=O)NN=Cc1cc(Cl)ccc1OCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C25H21ClN4O4/c1-33-23-5-3-2-4-21(23)29-24(31)13-25(32)30-28-15-19-12-20(26)10-11-22(19)34-16-18-8-6-17(14-27)7-9-18/h2-12,15H,13,16H2,1H3,(H,29,31)(H,30,32) |
| InChIKey | ZUMHPXXQJIMERL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.92 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|