C26H23ClN4O3 — CID 4044736
N'-[[5-chloro-2-[(4-cyanophenyl)methoxy]phenyl]methylideneamino]-N-(2,4-dimethylphenyl)propanediamide (PubChem CID 4044736) has the molecular formula C26H23ClN4O3 and a molecular weight of 474.95 g/mol. Its IUPAC name is N'-[[5-chloro-2-[(4-cyanophenyl)methoxy]phenyl]methylideneamino]-N-(2,4-dimethylphenyl)propanediamide.
| Compound Name | N'-[[5-chloro-2-[(4-cyanophenyl)methoxy]phenyl]methylideneamino]-N-(2,4-dimethylphenyl)propanediamide |
|---|---|
| PubChem CID | 4044736 |
| Molecular Formula | C26H23ClN4O3 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | N'-[[5-chloro-2-[(4-cyanophenyl)methoxy]phenyl]methylideneamino]-N-(2,4-dimethylphenyl)propanediamide |
| SMILES | Cc1ccc(NC(=O)CC(=O)NN=Cc2cc(Cl)ccc2OCc2ccc(C#N)cc2)c(C)c1 |
| InChI | InChI=1S/C26H23ClN4O3/c1-17-3-9-23(18(2)11-17)30-25(32)13-26(33)31-29-15-21-12-22(27)8-10-24(21)34-16-20-6-4-19(14-28)5-7-20/h3-12,15H,13,16H2,1-2H3,(H,30,32)(H,31,33) |
| InChIKey | SNHQRKWBDOCBSZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 103.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|