C17H16N4O6 — CID 4692567
2,4-dihydroxy-N-[[4-(3-nitroanilino)-4-oxobutan-2-ylidene]amino]benzamide (PubChem CID 4692567) has the molecular formula C17H16N4O6 and a molecular weight of 372.34 g/mol. Its IUPAC name is 2,4-dihydroxy-N-[[4-(3-nitroanilino)-4-oxobutan-2-ylidene]amino]benzamide.
| Compound Name | 2,4-dihydroxy-N-[[4-(3-nitroanilino)-4-oxobutan-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 4692567 |
| Molecular Formula | C17H16N4O6 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2,4-dihydroxy-N-[[4-(3-nitroanilino)-4-oxobutan-2-ylidene]amino]benzamide |
| SMILES | CC(CC(=O)Nc1cccc([N+](=O)[O-])c1)=NNC(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C17H16N4O6/c1-10(19-20-17(25)14-6-5-13(22)9-15(14)23)7-16(24)18-11-3-2-4-12(8-11)21(26)27/h2-6,8-9,22-23H,7H2,1H3,(H,18,24)(H,20,25) |
| InChIKey | YCQPFFSGEPDNNI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 154.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|