C19H17N5O6 — CID 137031467
2,4-dihydroxy-N-[(E)-1-[5-methyl-2-(3-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]benzamide (PubChem CID 137031467) has the molecular formula C19H17N5O6 and a molecular weight of 411.37 g/mol. Its IUPAC name is 2,4-dihydroxy-N-[(E)-1-[5-methyl-2-(3-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]benzamide.
| Compound Name | 2,4-dihydroxy-N-[(E)-1-[5-methyl-2-(3-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]benzamide |
|---|---|
| PubChem CID | 137031467 |
| Molecular Formula | C19H17N5O6 |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 2,4-dihydroxy-N-[(E)-1-[5-methyl-2-(3-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]ethylideneamino]benzamide |
| SMILES | C/C(=N\NC(=O)c1ccc(O)cc1O)c1c(C)[nH]n(-c2cccc([N+](=O)[O-])c2)c1=O |
| InChI | InChI=1S/C19H17N5O6/c1-10(20-21-18(27)15-7-6-14(25)9-16(15)26)17-11(2)22-23(19(17)28)12-4-3-5-13(8-12)24(29)30/h3-9,22,25-26H,1-2H3,(H,21,27)/b20-10+ |
| InChIKey | OKLNRNXAVLVRSU-KEBDBYFISA-N |
| XLogP | 1.95 |
| TPSA | 162.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|