C20H24N2O3 — CID 17337787
2,5-dihydroxy-N-[(E)-1-phenylheptylideneamino]benzamide (PubChem CID 17337787) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 2,5-dihydroxy-N-[(E)-1-phenylheptylideneamino]benzamide.
| Compound Name | 2,5-dihydroxy-N-[(E)-1-phenylheptylideneamino]benzamide |
|---|---|
| PubChem CID | 17337787 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 2,5-dihydroxy-N-[(E)-1-phenylheptylideneamino]benzamide |
| SMILES | CCCCCC/C(=N\NC(=O)c1cc(O)ccc1O)c1ccccc1 |
| InChI | InChI=1S/C20H24N2O3/c1-2-3-4-8-11-18(15-9-6-5-7-10-15)21-22-20(25)17-14-16(23)12-13-19(17)24/h5-7,9-10,12-14,23-24H,2-4,8,11H2,1H3,(H,22,25)/b21-18+ |
| InChIKey | DMYQXYOPPFFLLA-DYTRJAOYSA-N |
| XLogP | 4.20 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|